C22H22N2O2 — CID 77093047
4-(3-methoxyphenyl)-N-methyl-N-(2-pyridin-4-ylethyl)benzamide (PubChem CID 77093047) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-N-methyl-N-(2-pyridin-4-ylethyl)benzamide.
| Compound Name | 4-(3-methoxyphenyl)-N-methyl-N-(2-pyridin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 77093047 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 4-(3-methoxyphenyl)-N-methyl-N-(2-pyridin-4-ylethyl)benzamide |
| SMILES | COc1cccc(-c2ccc(C(=O)N(C)CCc3ccncc3)cc2)c1 |
| InChI | InChI=1S/C22H22N2O2/c1-24(15-12-17-10-13-23-14-11-17)22(25)19-8-6-18(7-9-19)20-4-3-5-21(16-20)26-2/h3-11,13-14,16H,12,15H2,1-2H3 |
| InChIKey | AWSPXKCBMXAHNP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |