C24H23ClN2O3 — CID 7709326
N-benzyl-4-[(2R)-1-(3-chloro-4-methylanilino)-1-oxopropan-2-yl]oxybenzamide (PubChem CID 7709326) has the molecular formula C24H23ClN2O3 and a molecular weight of 422.91 g/mol. Its IUPAC name is N-benzyl-4-[(2R)-1-(3-chloro-4-methylanilino)-1-oxopropan-2-yl]oxybenzamide.
| Compound Name | N-benzyl-4-[(2R)-1-(3-chloro-4-methylanilino)-1-oxopropan-2-yl]oxybenzamide |
|---|---|
| PubChem CID | 7709326 |
| Molecular Formula | C24H23ClN2O3 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-benzyl-4-[(2R)-1-(3-chloro-4-methylanilino)-1-oxopropan-2-yl]oxybenzamide |
| SMILES | Cc1ccc(NC(=O)[C@@H](C)Oc2ccc(C(=O)NCc3ccccc3)cc2)cc1Cl |
| InChI | InChI=1S/C24H23ClN2O3/c1-16-8-11-20(14-22(16)25)27-23(28)17(2)30-21-12-9-19(10-13-21)24(29)26-15-18-6-4-3-5-7-18/h3-14,17H,15H2,1-2H3,(H,26,29)(H,27,28)/t17-/m1/s1 |
| InChIKey | HJJASLXMWMFUEQ-QGZVFWFLSA-N |
| XLogP | 4.98 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |