C20H31N3O2 — CID 77093362
(3S)-3-benzyl-4-(2,2-dimethyl-3-morpholin-4-ylpropyl)piperazin-2-one (PubChem CID 77093362) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is (3S)-3-benzyl-4-(2,2-dimethyl-3-morpholin-4-ylpropyl)piperazin-2-one.
| Compound Name | (3S)-3-benzyl-4-(2,2-dimethyl-3-morpholin-4-ylpropyl)piperazin-2-one |
|---|---|
| PubChem CID | 77093362 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | (3S)-3-benzyl-4-(2,2-dimethyl-3-morpholin-4-ylpropyl)piperazin-2-one |
| SMILES | CC(C)(CN1CCOCC1)CN1CCNC(=O)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C20H31N3O2/c1-20(2,15-22-10-12-25-13-11-22)16-23-9-8-21-19(24)18(23)14-17-6-4-3-5-7-17/h3-7,18H,8-16H2,1-2H3,(H,21,24)/t18-/m0/s1 |
| InChIKey | HKWBNUYQCTZRPB-SFHVURJKSA-N |
| XLogP | 1.39 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |