C21H28N4O2 — CID 77094507
5-[(2-cyclopentyloxyphenyl)methyl]-N,N-dimethyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide (PubChem CID 77094507) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 5-[(2-cyclopentyloxyphenyl)methyl]-N,N-dimethyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide.
| Compound Name | 5-[(2-cyclopentyloxyphenyl)methyl]-N,N-dimethyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 77094507 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 5-[(2-cyclopentyloxyphenyl)methyl]-N,N-dimethyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide |
| SMILES | CN(C)C(=O)c1n[nH]c2c1CN(Cc1ccccc1OC1CCCC1)CC2 |
| InChI | InChI=1S/C21H28N4O2/c1-24(2)21(26)20-17-14-25(12-11-18(17)22-23-20)13-15-7-3-6-10-19(15)27-16-8-4-5-9-16/h3,6-7,10,16H,4-5,8-9,11-14H2,1-2H3,(H,22,23) |
| InChIKey | OUSGOSSHVDKNBV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |