C16H24N2OS — CID 77094777
(2R)-N-methyl-N-[3-(4-methylphenyl)sulfanylpropyl]pyrrolidine-2-carboxamide (PubChem CID 77094777) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is (2R)-N-methyl-N-[3-(4-methylphenyl)sulfanylpropyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-methyl-N-[3-(4-methylphenyl)sulfanylpropyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 77094777 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | (2R)-N-methyl-N-[3-(4-methylphenyl)sulfanylpropyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(SCCCN(C)C(=O)[C@H]2CCCN2)cc1 |
| InChI | InChI=1S/C16H24N2OS/c1-13-6-8-14(9-7-13)20-12-4-11-18(2)16(19)15-5-3-10-17-15/h6-9,15,17H,3-5,10-12H2,1-2H3/t15-/m1/s1 |
| InChIKey | KSRHWUTWKRBBQB-OAHLLOKOSA-N |
| XLogP | 2.69 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|