About 3-methyl-5-[(4-pyridin-3-yloxypiperidin-1-yl)methyl]-1,2-oxazole
3-methyl-5-[(4-pyridin-3-yloxypiperidin-1-yl)methyl]-1,2-oxazole (PubChem CID 77094813) has the molecular formula C15H19N3O2
and a molecular weight of 273.34 g/mol. Its IUPAC name is 3-methyl-5-[(4-pyridin-3-yloxypiperidin-1-yl)methyl]-1,2-oxazole.
Molecular Properties
| Compound Name | 3-methyl-5-[(4-pyridin-3-yloxypiperidin-1-yl)methyl]-1,2-oxazole |
| PubChem CID | 77094813 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 3-methyl-5-[(4-pyridin-3-yloxypiperidin-1-yl)methyl]-1,2-oxazole |
| SMILES | Cc1cc(CN2CCC(Oc3cccnc3)CC2)on1 |
| InChI | InChI=1S/C15H19N3O2/c1-12-9-15(20-17-12)11-18-7-4-13(5-8-18)19-14-3-2-6-16-10-14/h2-3,6,9-10,13H,4-5,7-8,11H2,1H3 |
| InChIKey | NVFRCIDHGAGWFC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-methyl-5-[(4-pyridin-3-yloxypiperidin-1-yl)methyl]-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-[(4-pyridin-3-yloxypiperidin-1-yl)methyl]-1,2-oxazole?
The IUPAC name of 3-methyl-5-[(4-pyridin-3-yloxypiperidin-1-yl)methyl]-1,2-oxazole (CID 77094813) is 3-methyl-5-[(4-pyridin-3-yloxypiperidin-1-yl)methyl]-1,2-oxazole.
What is the SMILES notation for 3-methyl-5-[(4-pyridin-3-yloxypiperidin-1-yl)methyl]-1,2-oxazole?
The canonical SMILES for 3-methyl-5-[(4-pyridin-3-yloxypiperidin-1-yl)methyl]-1,2-oxazole is Cc1cc(CN2CCC(Oc3cccnc3)CC2)on1.
What is the InChIKey of 3-methyl-5-[(4-pyridin-3-yloxypiperidin-1-yl)methyl]-1,2-oxazole?
The InChIKey is NVFRCIDHGAGWFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O2/c1-12-9-15(20-17-12)11-18-7-4-13(5-8-18)19-14-3-2-6-16-10-14/h2-3,6,9-10,13H,4-5,7-8,11H2,1H3.
What are the key properties of 3-methyl-5-[(4-pyridin-3-yloxypiperidin-1-yl)methyl]-1,2-oxazole?
3-methyl-5-[(4-pyridin-3-yloxypiperidin-1-yl)methyl]-1,2-oxazole has a molecular weight of 273.34 g/mol, XLogP of 2.42, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-[(4-pyridin-3-yloxypiperidin-1-yl)methyl]-1,2-oxazole is sourced from PubChem (CID 77094813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).