C14H16N8O — CID 77094882
N-[(5-ethyl-2-pyridinyl)methyl]-N-methyl-5-(tetrazol-1-yl)-1H-pyrazole-4-carboxamide (PubChem CID 77094882) has the molecular formula C14H16N8O and a molecular weight of 312.34 g/mol. Its IUPAC name is N-[(5-ethyl-2-pyridinyl)methyl]-N-methyl-5-(tetrazol-1-yl)-1H-pyrazole-4-carboxamide.
| Compound Name | N-[(5-ethyl-2-pyridinyl)methyl]-N-methyl-5-(tetrazol-1-yl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 77094882 |
| Molecular Formula | C14H16N8O |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | N-[(5-ethyl-2-pyridinyl)methyl]-N-methyl-5-(tetrazol-1-yl)-1H-pyrazole-4-carboxamide |
| SMILES | CCc1ccc(CN(C)C(=O)c2cn[nH]c2-n2cnnn2)nc1 |
| InChI | InChI=1S/C14H16N8O/c1-3-10-4-5-11(15-6-10)8-21(2)14(23)12-7-16-18-13(12)22-9-17-19-20-22/h4-7,9H,3,8H2,1-2H3,(H,16,18) |
| InChIKey | RXHXPEPSOCJRBX-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |