About 2-(ethylamino)-4-methyl-N-(1-pyrazin-2-ylpiperidin-3-yl)-1,3-thiazole-5-carboxamide
2-(ethylamino)-4-methyl-N-(1-pyrazin-2-ylpiperidin-3-yl)-1,3-thiazole-5-carboxamide (PubChem CID 77094920) has the molecular formula C16H22N6OS
and a molecular weight of 346.46 g/mol. Its IUPAC name is 2-(ethylamino)-4-methyl-N-(1-pyrazin-2-ylpiperidin-3-yl)-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-(ethylamino)-4-methyl-N-(1-pyrazin-2-ylpiperidin-3-yl)-1,3-thiazole-5-carboxamide |
| PubChem CID | 77094920 |
| Molecular Formula | C16H22N6OS |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 2-(ethylamino)-4-methyl-N-(1-pyrazin-2-ylpiperidin-3-yl)-1,3-thiazole-5-carboxamide |
| SMILES | CCNc1nc(C)c(C(=O)NC2CCCN(c3cnccn3)C2)s1 |
| InChI | InChI=1S/C16H22N6OS/c1-3-18-16-20-11(2)14(24-16)15(23)21-12-5-4-8-22(10-12)13-9-17-6-7-19-13/h6-7,9,12H,3-5,8,10H2,1-2H3,(H,18,20)(H,21,23) |
| InChIKey | CAVBQBADHVIGCO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(ethylamino)-4-methyl-N-(1-pyrazin-2-ylpiperidin-3-yl)-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethylamino)-4-methyl-N-(1-pyrazin-2-ylpiperidin-3-yl)-1,3-thiazole-5-carboxamide?
The IUPAC name of 2-(ethylamino)-4-methyl-N-(1-pyrazin-2-ylpiperidin-3-yl)-1,3-thiazole-5-carboxamide (CID 77094920) is 2-(ethylamino)-4-methyl-N-(1-pyrazin-2-ylpiperidin-3-yl)-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 2-(ethylamino)-4-methyl-N-(1-pyrazin-2-ylpiperidin-3-yl)-1,3-thiazole-5-carboxamide?
The canonical SMILES for 2-(ethylamino)-4-methyl-N-(1-pyrazin-2-ylpiperidin-3-yl)-1,3-thiazole-5-carboxamide is CCNc1nc(C)c(C(=O)NC2CCCN(c3cnccn3)C2)s1.
What is the InChIKey of 2-(ethylamino)-4-methyl-N-(1-pyrazin-2-ylpiperidin-3-yl)-1,3-thiazole-5-carboxamide?
The InChIKey is CAVBQBADHVIGCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N6OS/c1-3-18-16-20-11(2)14(24-16)15(23)21-12-5-4-8-22(10-12)13-9-17-6-7-19-13/h6-7,9,12H,3-5,8,10H2,1-2H3,(H,18,20)(H,21,23).
What are the key properties of 2-(ethylamino)-4-methyl-N-(1-pyrazin-2-ylpiperidin-3-yl)-1,3-thiazole-5-carboxamide?
2-(ethylamino)-4-methyl-N-(1-pyrazin-2-ylpiperidin-3-yl)-1,3-thiazole-5-carboxamide has a molecular weight of 346.46 g/mol, XLogP of 2.07, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylamino)-4-methyl-N-(1-pyrazin-2-ylpiperidin-3-yl)-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 77094920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).