C19H21N5O2 — CID 77095447
2-methyl-N-[3-(2-methylimidazol-1-yl)-1-phenylpropyl]-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 77095447) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 2-methyl-N-[3-(2-methylimidazol-1-yl)-1-phenylpropyl]-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | 2-methyl-N-[3-(2-methylimidazol-1-yl)-1-phenylpropyl]-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 77095447 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 2-methyl-N-[3-(2-methylimidazol-1-yl)-1-phenylpropyl]-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | Cc1ncc(C(=O)NC(CCn2ccnc2C)c2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C19H21N5O2/c1-13-21-12-16(18(25)22-13)19(26)23-17(15-6-4-3-5-7-15)8-10-24-11-9-20-14(24)2/h3-7,9,11-12,17H,8,10H2,1-2H3,(H,23,26)(H,21,22,25) |
| InChIKey | FXCWMCVTYDUZHH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |