C22H18ClNO3 — CID 7709575
[(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl] 4-phenylbenzoate (PubChem CID 7709575) has the molecular formula C22H18ClNO3 and a molecular weight of 379.84 g/mol. Its IUPAC name is [(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl] 4-phenylbenzoate.
| Compound Name | [(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 7709575 |
| Molecular Formula | C22H18ClNO3 |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | [(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl] 4-phenylbenzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(-c2ccccc2)cc1)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H18ClNO3/c1-15(21(25)24-20-13-11-19(23)12-14-20)27-22(26)18-9-7-17(8-10-18)16-5-3-2-4-6-16/h2-15H,1H3,(H,24,25)/t15-/m1/s1 |
| InChIKey | RABGVFPFMUDXFD-OAHLLOKOSA-N |
| XLogP | 5.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |