About 5-[[methyl(1,2-oxazol-3-ylmethyl)amino]methyl]-N-propylpyrimidin-2-amine
5-[[methyl(1,2-oxazol-3-ylmethyl)amino]methyl]-N-propylpyrimidin-2-amine (PubChem CID 77096379) has the molecular formula C13H19N5O
and a molecular weight of 261.33 g/mol. Its IUPAC name is 5-[[methyl(1,2-oxazol-3-ylmethyl)amino]methyl]-N-propylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-[[methyl(1,2-oxazol-3-ylmethyl)amino]methyl]-N-propylpyrimidin-2-amine |
| PubChem CID | 77096379 |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 5-[[methyl(1,2-oxazol-3-ylmethyl)amino]methyl]-N-propylpyrimidin-2-amine |
| SMILES | CCCNc1ncc(CN(C)Cc2ccon2)cn1 |
| InChI | InChI=1S/C13H19N5O/c1-3-5-14-13-15-7-11(8-16-13)9-18(2)10-12-4-6-19-17-12/h4,6-8H,3,5,9-10H2,1-2H3,(H,14,15,16) |
| InChIKey | YMTKPMOMDYDYDV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 67.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[[methyl(1,2-oxazol-3-ylmethyl)amino]methyl]-N-propylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[methyl(1,2-oxazol-3-ylmethyl)amino]methyl]-N-propylpyrimidin-2-amine?
The IUPAC name of 5-[[methyl(1,2-oxazol-3-ylmethyl)amino]methyl]-N-propylpyrimidin-2-amine (CID 77096379) is 5-[[methyl(1,2-oxazol-3-ylmethyl)amino]methyl]-N-propylpyrimidin-2-amine.
What is the SMILES notation for 5-[[methyl(1,2-oxazol-3-ylmethyl)amino]methyl]-N-propylpyrimidin-2-amine?
The canonical SMILES for 5-[[methyl(1,2-oxazol-3-ylmethyl)amino]methyl]-N-propylpyrimidin-2-amine is CCCNc1ncc(CN(C)Cc2ccon2)cn1.
What is the InChIKey of 5-[[methyl(1,2-oxazol-3-ylmethyl)amino]methyl]-N-propylpyrimidin-2-amine?
The InChIKey is YMTKPMOMDYDYDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N5O/c1-3-5-14-13-15-7-11(8-16-13)9-18(2)10-12-4-6-19-17-12/h4,6-8H,3,5,9-10H2,1-2H3,(H,14,15,16).
What are the key properties of 5-[[methyl(1,2-oxazol-3-ylmethyl)amino]methyl]-N-propylpyrimidin-2-amine?
5-[[methyl(1,2-oxazol-3-ylmethyl)amino]methyl]-N-propylpyrimidin-2-amine has a molecular weight of 261.33 g/mol, XLogP of 1.92, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[methyl(1,2-oxazol-3-ylmethyl)amino]methyl]-N-propylpyrimidin-2-amine is sourced from PubChem (CID 77096379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).