C19H25N3O3 — CID 77097117
2-[1-[[4-methoxy-3-(methoxymethyl)phenyl]methyl]piperidin-4-yl]oxypyrimidine (PubChem CID 77097117) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 2-[1-[[4-methoxy-3-(methoxymethyl)phenyl]methyl]piperidin-4-yl]oxypyrimidine.
| Compound Name | 2-[1-[[4-methoxy-3-(methoxymethyl)phenyl]methyl]piperidin-4-yl]oxypyrimidine |
|---|---|
| PubChem CID | 77097117 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 2-[1-[[4-methoxy-3-(methoxymethyl)phenyl]methyl]piperidin-4-yl]oxypyrimidine |
| SMILES | COCc1cc(CN2CCC(Oc3ncccn3)CC2)ccc1OC |
| InChI | InChI=1S/C19H25N3O3/c1-23-14-16-12-15(4-5-18(16)24-2)13-22-10-6-17(7-11-22)25-19-20-8-3-9-21-19/h3-5,8-9,12,17H,6-7,10-11,13-14H2,1-2H3 |
| InChIKey | TZDAQUMXHXIOHB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |