C20H27ClN4 — CID 77097247
1-[(5-chloro-3-ethyl-1-methylpyrazol-4-yl)methyl]-4-[(E)-3-phenylprop-2-enyl]piperazine (PubChem CID 77097247) has the molecular formula C20H27ClN4 and a molecular weight of 358.92 g/mol. Its IUPAC name is 1-[(5-chloro-3-ethyl-1-methylpyrazol-4-yl)methyl]-4-[(E)-3-phenylprop-2-enyl]piperazine.
| Compound Name | 1-[(5-chloro-3-ethyl-1-methylpyrazol-4-yl)methyl]-4-[(E)-3-phenylprop-2-enyl]piperazine |
|---|---|
| PubChem CID | 77097247 |
| Molecular Formula | C20H27ClN4 |
| Molecular Weight | 358.92 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 1-[(5-chloro-3-ethyl-1-methylpyrazol-4-yl)methyl]-4-[(E)-3-phenylprop-2-enyl]piperazine |
| SMILES | CCc1nn(C)c(Cl)c1CN1CCN(C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C20H27ClN4/c1-3-19-18(20(21)23(2)22-19)16-25-14-12-24(13-15-25)11-7-10-17-8-5-4-6-9-17/h4-10H,3,11-16H2,1-2H3/b10-7+ |
| InChIKey | YAVZPPYVQPBYGX-JXMROGBWSA-N |
| XLogP | 3.47 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.92 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |