C18H22N4O — CID 77097556
3-[1-[(2,3-dimethyl-1H-indol-7-yl)methyl]piperidin-4-yl]-1,2,4-oxadiazole (PubChem CID 77097556) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is 3-[1-[(2,3-dimethyl-1H-indol-7-yl)methyl]piperidin-4-yl]-1,2,4-oxadiazole.
| Compound Name | 3-[1-[(2,3-dimethyl-1H-indol-7-yl)methyl]piperidin-4-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 77097556 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 3-[1-[(2,3-dimethyl-1H-indol-7-yl)methyl]piperidin-4-yl]-1,2,4-oxadiazole |
| SMILES | Cc1[nH]c2c(CN3CCC(c4ncon4)CC3)cccc2c1C |
| InChI | InChI=1S/C18H22N4O/c1-12-13(2)20-17-15(4-3-5-16(12)17)10-22-8-6-14(7-9-22)18-19-11-23-21-18/h3-5,11,14,20H,6-10H2,1-2H3 |
| InChIKey | NSCZQYFSMHUNGO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|