C17H23N7O — CID 77097569
(2-amino-5,6,7,8-tetrahydroquinazolin-4-yl)-[4-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]methanone (PubChem CID 77097569) has the molecular formula C17H23N7O and a molecular weight of 341.42 g/mol. Its IUPAC name is (2-amino-5,6,7,8-tetrahydroquinazolin-4-yl)-[4-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]methanone.
| Compound Name | (2-amino-5,6,7,8-tetrahydroquinazolin-4-yl)-[4-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 77097569 |
| Molecular Formula | C17H23N7O |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | (2-amino-5,6,7,8-tetrahydroquinazolin-4-yl)-[4-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]methanone |
| SMILES | Cc1nc(C2CCN(C(=O)c3nc(N)nc4c3CCCC4)CC2)n[nH]1 |
| InChI | InChI=1S/C17H23N7O/c1-10-19-15(23-22-10)11-6-8-24(9-7-11)16(25)14-12-4-2-3-5-13(12)20-17(18)21-14/h11H,2-9H2,1H3,(H2,18,20,21)(H,19,22,23) |
| InChIKey | JSJJSOQTVHMUIE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |