3-(1,3-benzothiazol-2-yl)propanoic acid

C10H9NO2S — CID 770976

IUPAC3-(1,3-benzothiazol-2-yl)propanoic acid
SMILESO=C(O)CCc1nc2ccccc2s1
InChIInChI=1S/C10H9NO2S/c12-10(13)6-5-9-11-7-3-1-2-4-8(7)14-9/h1-4H,5-6H2,(H,12,13)
InChIKeyWHNQTHDJEZTVHS-UHFFFAOYSA-N
MW207.25 g/mol
LogP2.31
Rot. Bonds3

About 3-(1,3-benzothiazol-2-yl)propanoic acid

3-(1,3-benzothiazol-2-yl)propanoic acid (PubChem CID 770976) has the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)propanoic acid.

Molecular Properties

Compound Name3-(1,3-benzothiazol-2-yl)propanoic acid
PubChem CID770976
Molecular FormulaC10H9NO2S
Molecular Weight207.25 g/mol
Exact Mass207.04
IUPAC Name3-(1,3-benzothiazol-2-yl)propanoic acid
SMILESO=C(O)CCc1nc2ccccc2s1
InChIInChI=1S/C10H9NO2S/c12-10(13)6-5-9-11-7-3-1-2-4-8(7)14-9/h1-4H,5-6H2,(H,12,13)
InChIKeyWHNQTHDJEZTVHS-UHFFFAOYSA-N
XLogP2.31
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.25
LogP ≤ 52.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(1,3-benzothiazol-2-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1,3-benzothiazol-2-yl)propanoic acid?
The IUPAC name of 3-(1,3-benzothiazol-2-yl)propanoic acid (CID 770976) is 3-(1,3-benzothiazol-2-yl)propanoic acid.
What is the SMILES notation for 3-(1,3-benzothiazol-2-yl)propanoic acid?
The canonical SMILES for 3-(1,3-benzothiazol-2-yl)propanoic acid is O=C(O)CCc1nc2ccccc2s1.
What is the InChIKey of 3-(1,3-benzothiazol-2-yl)propanoic acid?
The InChIKey is WHNQTHDJEZTVHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2S/c12-10(13)6-5-9-11-7-3-1-2-4-8(7)14-9/h1-4H,5-6H2,(H,12,13).
What are the key properties of 3-(1,3-benzothiazol-2-yl)propanoic acid?
3-(1,3-benzothiazol-2-yl)propanoic acid has a molecular weight of 207.25 g/mol, XLogP of 2.31, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzothiazol-2-yl)propanoic acid is sourced from PubChem (CID 770976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).