About 8-amino-4-methyl-9-oxo-6-thia-1-azatricyclo[5.2.0.02,4]nonane-2-carboxylic acid
8-amino-4-methyl-9-oxo-6-thia-1-azatricyclo[5.2.0.02,4]nonane-2-carboxylic acid (PubChem CID 77098500) has the molecular formula C9H12N2O3S
and a molecular weight of 228.27 g/mol. Its IUPAC name is 8-amino-4-methyl-9-oxo-6-thia-1-azatricyclo[5.2.0.02,4]nonane-2-carboxylic acid.
Molecular Properties
| Compound Name | 8-amino-4-methyl-9-oxo-6-thia-1-azatricyclo[5.2.0.02,4]nonane-2-carboxylic acid |
| PubChem CID | 77098500 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 8-amino-4-methyl-9-oxo-6-thia-1-azatricyclo[5.2.0.02,4]nonane-2-carboxylic acid |
| SMILES | CC12CSC3C(N)C(=O)N3C1(C(=O)O)C2 |
| InChI | InChI=1S/C9H12N2O3S/c1-8-2-9(8,7(13)14)11-5(12)4(10)6(11)15-3-8/h4,6H,2-3,10H2,1H3,(H,13,14) |
| InChIKey | PGWQEUKLCXVZBB-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-amino-4-methyl-9-oxo-6-thia-1-azatricyclo[5.2.0.02,4]nonane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-4-methyl-9-oxo-6-thia-1-azatricyclo[5.2.0.02,4]nonane-2-carboxylic acid?
The IUPAC name of 8-amino-4-methyl-9-oxo-6-thia-1-azatricyclo[5.2.0.02,4]nonane-2-carboxylic acid (CID 77098500) is 8-amino-4-methyl-9-oxo-6-thia-1-azatricyclo[5.2.0.02,4]nonane-2-carboxylic acid.
What is the SMILES notation for 8-amino-4-methyl-9-oxo-6-thia-1-azatricyclo[5.2.0.02,4]nonane-2-carboxylic acid?
The canonical SMILES for 8-amino-4-methyl-9-oxo-6-thia-1-azatricyclo[5.2.0.02,4]nonane-2-carboxylic acid is CC12CSC3C(N)C(=O)N3C1(C(=O)O)C2.
What is the InChIKey of 8-amino-4-methyl-9-oxo-6-thia-1-azatricyclo[5.2.0.02,4]nonane-2-carboxylic acid?
The InChIKey is PGWQEUKLCXVZBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3S/c1-8-2-9(8,7(13)14)11-5(12)4(10)6(11)15-3-8/h4,6H,2-3,10H2,1H3,(H,13,14).
What are the key properties of 8-amino-4-methyl-9-oxo-6-thia-1-azatricyclo[5.2.0.02,4]nonane-2-carboxylic acid?
8-amino-4-methyl-9-oxo-6-thia-1-azatricyclo[5.2.0.02,4]nonane-2-carboxylic acid has a molecular weight of 228.27 g/mol, XLogP of -0.54, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-4-methyl-9-oxo-6-thia-1-azatricyclo[5.2.0.02,4]nonane-2-carboxylic acid is sourced from PubChem (CID 77098500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).