C10H19N5O — CID 77099023
2-(3,5-diethyl-1,2,4-triazol-1-yl)-N'-hydroxybutanimidamide (PubChem CID 77099023) has the molecular formula C10H19N5O and a molecular weight of 225.30 g/mol. Its IUPAC name is 2-(3,5-diethyl-1,2,4-triazol-1-yl)-N'-hydroxybutanimidamide.
| Compound Name | 2-(3,5-diethyl-1,2,4-triazol-1-yl)-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 77099023 |
| Molecular Formula | C10H19N5O |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 2-(3,5-diethyl-1,2,4-triazol-1-yl)-N'-hydroxybutanimidamide |
| SMILES | CCc1nc(CC)n(C(CC)C(N)=NO)n1 |
| InChI | InChI=1S/C10H19N5O/c1-4-7(10(11)14-16)15-9(6-3)12-8(5-2)13-15/h7,16H,4-6H2,1-3H3,(H2,11,14) |
| InChIKey | JNNGREHDQQOJMH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|