About 2-[5-(2,5-difluorophenyl)pyrazolidin-3-yl]ethanamine
2-[5-(2,5-difluorophenyl)pyrazolidin-3-yl]ethanamine (PubChem CID 77099182) has the molecular formula C11H15F2N3
and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-[5-(2,5-difluorophenyl)pyrazolidin-3-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[5-(2,5-difluorophenyl)pyrazolidin-3-yl]ethanamine |
| PubChem CID | 77099182 |
| Molecular Formula | C11H15F2N3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 2-[5-(2,5-difluorophenyl)pyrazolidin-3-yl]ethanamine |
| SMILES | NCCC1CC(c2cc(F)ccc2F)NN1 |
| InChI | InChI=1S/C11H15F2N3/c12-7-1-2-10(13)9(5-7)11-6-8(3-4-14)15-16-11/h1-2,5,8,11,15-16H,3-4,6,14H2 |
| InChIKey | YHQVMGDMOVEDBJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[5-(2,5-difluorophenyl)pyrazolidin-3-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(2,5-difluorophenyl)pyrazolidin-3-yl]ethanamine?
The IUPAC name of 2-[5-(2,5-difluorophenyl)pyrazolidin-3-yl]ethanamine (CID 77099182) is 2-[5-(2,5-difluorophenyl)pyrazolidin-3-yl]ethanamine.
What is the SMILES notation for 2-[5-(2,5-difluorophenyl)pyrazolidin-3-yl]ethanamine?
The canonical SMILES for 2-[5-(2,5-difluorophenyl)pyrazolidin-3-yl]ethanamine is NCCC1CC(c2cc(F)ccc2F)NN1.
What is the InChIKey of 2-[5-(2,5-difluorophenyl)pyrazolidin-3-yl]ethanamine?
The InChIKey is YHQVMGDMOVEDBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F2N3/c12-7-1-2-10(13)9(5-7)11-6-8(3-4-14)15-16-11/h1-2,5,8,11,15-16H,3-4,6,14H2.
What are the key properties of 2-[5-(2,5-difluorophenyl)pyrazolidin-3-yl]ethanamine?
2-[5-(2,5-difluorophenyl)pyrazolidin-3-yl]ethanamine has a molecular weight of 227.26 g/mol, XLogP of 1.22, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2,5-difluorophenyl)pyrazolidin-3-yl]ethanamine is sourced from PubChem (CID 77099182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).