C10H9F3N2O3S — CID 77099540
3-[2-(4,4,4-trifluorobutanoylamino)-1,3-thiazol-5-yl]prop-2-enoic acid (PubChem CID 77099540) has the molecular formula C10H9F3N2O3S and a molecular weight of 294.25 g/mol. Its IUPAC name is 3-[2-(4,4,4-trifluorobutanoylamino)-1,3-thiazol-5-yl]prop-2-enoic acid.
| Compound Name | 3-[2-(4,4,4-trifluorobutanoylamino)-1,3-thiazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77099540 |
| Molecular Formula | C10H9F3N2O3S |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 3-[2-(4,4,4-trifluorobutanoylamino)-1,3-thiazol-5-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cnc(NC(=O)CCC(F)(F)F)s1 |
| InChI | InChI=1S/C10H9F3N2O3S/c11-10(12,13)4-3-7(16)15-9-14-5-6(19-9)1-2-8(17)18/h1-2,5H,3-4H2,(H,17,18)(H,14,15,16) |
| InChIKey | RMFBRFWAMBLMQK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|