C11H19F3N4O2 — CID 77099612
N-[1-(2-amino-2-hydroxyiminoethyl)piperidin-4-yl]-4,4,4-trifluorobutanamide (PubChem CID 77099612) has the molecular formula C11H19F3N4O2 and a molecular weight of 296.29 g/mol. Its IUPAC name is N-[1-(2-amino-2-hydroxyiminoethyl)piperidin-4-yl]-4,4,4-trifluorobutanamide.
| Compound Name | N-[1-(2-amino-2-hydroxyiminoethyl)piperidin-4-yl]-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 77099612 |
| Molecular Formula | C11H19F3N4O2 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | N-[1-(2-amino-2-hydroxyiminoethyl)piperidin-4-yl]-4,4,4-trifluorobutanamide |
| SMILES | NC(CN1CCC(NC(=O)CCC(F)(F)F)CC1)=NO |
| InChI | InChI=1S/C11H19F3N4O2/c12-11(13,14)4-1-10(19)16-8-2-5-18(6-3-8)7-9(15)17-20/h8,20H,1-7H2,(H2,15,17)(H,16,19) |
| InChIKey | SUUBVVKLLNHHQT-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|