C9H12N2OS — CID 771003
N-(5-methyl-1,3-thiazol-2-yl)cyclobutanecarboxamide (PubChem CID 771003) has the molecular formula C9H12N2OS and a molecular weight of 196.27 g/mol. Its IUPAC name is N-(5-methyl-1,3-thiazol-2-yl)cyclobutanecarboxamide.
| Compound Name | N-(5-methyl-1,3-thiazol-2-yl)cyclobutanecarboxamide |
|---|---|
| PubChem CID | 771003 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | N-(5-methyl-1,3-thiazol-2-yl)cyclobutanecarboxamide |
| SMILES | Cc1cnc(NC(=O)C2CCC2)s1 |
| InChI | InChI=1S/C9H12N2OS/c1-6-5-10-9(13-6)11-8(12)7-3-2-4-7/h5,7H,2-4H2,1H3,(H,10,11,12) |
| InChIKey | VCKNRPVOHXBMAF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |