C13H14F3NO3 — CID 77100333
N-[5-[2-(trifluoromethoxy)ethoxy]-3,4-dihydro-2H-naphthalen-1-ylidene]hydroxylamine (PubChem CID 77100333) has the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. Its IUPAC name is N-[5-[2-(trifluoromethoxy)ethoxy]-3,4-dihydro-2H-naphthalen-1-ylidene]hydroxylamine.
| Compound Name | N-[5-[2-(trifluoromethoxy)ethoxy]-3,4-dihydro-2H-naphthalen-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 77100333 |
| Molecular Formula | C13H14F3NO3 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-[5-[2-(trifluoromethoxy)ethoxy]-3,4-dihydro-2H-naphthalen-1-ylidene]hydroxylamine |
| SMILES | ON=C1CCCc2c(OCCOC(F)(F)F)cccc21 |
| InChI | InChI=1S/C13H14F3NO3/c14-13(15,16)20-8-7-19-12-6-2-3-9-10(12)4-1-5-11(9)17-18/h2-3,6,18H,1,4-5,7-8H2 |
| InChIKey | VKSFUFVXAPRJCF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|