methyl 2-ethyl-4-(4-methyl-2,3-dioxopiperazin-1-yl)but-2-enoate

C12H18N2O4 — CID 77100738

IUPACmethyl 2-ethyl-4-(4-methyl-2,3-dioxopiperazin-1-yl)but-2-enoate
SMILESCCC(=CCN1CCN(C)C(=O)C1=O)C(=O)OC
InChIInChI=1S/C12H18N2O4/c1-4-9(12(17)18-3)5-6-14-8-7-13(2)10(15)11(14)16/h5H,4,6-8H2,1-3H3
InChIKeyPZTAJFTXNMRDFL-UHFFFAOYSA-N
MW254.29 g/mol
LogP-0.20
Rot. Bonds4

About methyl 2-ethyl-4-(4-methyl-2,3-dioxopiperazin-1-yl)but-2-enoate

methyl 2-ethyl-4-(4-methyl-2,3-dioxopiperazin-1-yl)but-2-enoate (PubChem CID 77100738) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is methyl 2-ethyl-4-(4-methyl-2,3-dioxopiperazin-1-yl)but-2-enoate.

Molecular Properties

Compound Namemethyl 2-ethyl-4-(4-methyl-2,3-dioxopiperazin-1-yl)but-2-enoate
PubChem CID77100738
Molecular FormulaC12H18N2O4
Molecular Weight254.29 g/mol
Exact Mass254.13
IUPAC Namemethyl 2-ethyl-4-(4-methyl-2,3-dioxopiperazin-1-yl)but-2-enoate
SMILESCCC(=CCN1CCN(C)C(=O)C1=O)C(=O)OC
InChIInChI=1S/C12H18N2O4/c1-4-9(12(17)18-3)5-6-14-8-7-13(2)10(15)11(14)16/h5H,4,6-8H2,1-3H3
InChIKeyPZTAJFTXNMRDFL-UHFFFAOYSA-N
XLogP-0.20
TPSA66.92 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.29
LogP ≤ 5-0.20
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl 2-ethyl-4-(4-methyl-2,3-dioxopiperazin-1-yl)but-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-ethyl-4-(4-methyl-2,3-dioxopiperazin-1-yl)but-2-enoate?
The IUPAC name of methyl 2-ethyl-4-(4-methyl-2,3-dioxopiperazin-1-yl)but-2-enoate (CID 77100738) is methyl 2-ethyl-4-(4-methyl-2,3-dioxopiperazin-1-yl)but-2-enoate.
What is the SMILES notation for methyl 2-ethyl-4-(4-methyl-2,3-dioxopiperazin-1-yl)but-2-enoate?
The canonical SMILES for methyl 2-ethyl-4-(4-methyl-2,3-dioxopiperazin-1-yl)but-2-enoate is CCC(=CCN1CCN(C)C(=O)C1=O)C(=O)OC.
What is the InChIKey of methyl 2-ethyl-4-(4-methyl-2,3-dioxopiperazin-1-yl)but-2-enoate?
The InChIKey is PZTAJFTXNMRDFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O4/c1-4-9(12(17)18-3)5-6-14-8-7-13(2)10(15)11(14)16/h5H,4,6-8H2,1-3H3.
What are the key properties of methyl 2-ethyl-4-(4-methyl-2,3-dioxopiperazin-1-yl)but-2-enoate?
methyl 2-ethyl-4-(4-methyl-2,3-dioxopiperazin-1-yl)but-2-enoate has a molecular weight of 254.29 g/mol, XLogP of -0.20, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-ethyl-4-(4-methyl-2,3-dioxopiperazin-1-yl)but-2-enoate is sourced from PubChem (CID 77100738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).