methyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-ethylbut-2-enoate

C14H24N2O3 — CID 77100776

IUPACmethyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-ethylbut-2-enoate
SMILESCCC(=CCN1CCCN(C(C)=O)CC1)C(=O)OC
InChIInChI=1S/C14H24N2O3/c1-4-13(14(18)19-3)6-9-15-7-5-8-16(11-10-15)12(2)17/h6H,4-5,7-11H2,1-3H3
InChIKeyZMOGIBCTWQBDIE-UHFFFAOYSA-N
MW268.36 g/mol
LogP1.05
Rot. Bonds4

About methyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-ethylbut-2-enoate

methyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-ethylbut-2-enoate (PubChem CID 77100776) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is methyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-ethylbut-2-enoate.

Molecular Properties

Compound Namemethyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-ethylbut-2-enoate
PubChem CID77100776
Molecular FormulaC14H24N2O3
Molecular Weight268.36 g/mol
Exact Mass268.18
IUPAC Namemethyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-ethylbut-2-enoate
SMILESCCC(=CCN1CCCN(C(C)=O)CC1)C(=O)OC
InChIInChI=1S/C14H24N2O3/c1-4-13(14(18)19-3)6-9-15-7-5-8-16(11-10-15)12(2)17/h6H,4-5,7-11H2,1-3H3
InChIKeyZMOGIBCTWQBDIE-UHFFFAOYSA-N
XLogP1.05
TPSA49.85 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.36
LogP ≤ 51.05
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-ethylbut-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-ethylbut-2-enoate?
The IUPAC name of methyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-ethylbut-2-enoate (CID 77100776) is methyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-ethylbut-2-enoate.
What is the SMILES notation for methyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-ethylbut-2-enoate?
The canonical SMILES for methyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-ethylbut-2-enoate is CCC(=CCN1CCCN(C(C)=O)CC1)C(=O)OC.
What is the InChIKey of methyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-ethylbut-2-enoate?
The InChIKey is ZMOGIBCTWQBDIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O3/c1-4-13(14(18)19-3)6-9-15-7-5-8-16(11-10-15)12(2)17/h6H,4-5,7-11H2,1-3H3.
What are the key properties of methyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-ethylbut-2-enoate?
methyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-ethylbut-2-enoate has a molecular weight of 268.36 g/mol, XLogP of 1.05, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(4-acetyl-1,4-diazepan-1-yl)-2-ethylbut-2-enoate is sourced from PubChem (CID 77100776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).