About methyl 2-ethyl-4-(4-methyl-1,4-diazepan-1-yl)but-2-enoate
methyl 2-ethyl-4-(4-methyl-1,4-diazepan-1-yl)but-2-enoate (PubChem CID 77100973) has the molecular formula C13H24N2O2
and a molecular weight of 240.35 g/mol. Its IUPAC name is methyl 2-ethyl-4-(4-methyl-1,4-diazepan-1-yl)but-2-enoate.
Molecular Properties
| Compound Name | methyl 2-ethyl-4-(4-methyl-1,4-diazepan-1-yl)but-2-enoate |
| PubChem CID | 77100973 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | methyl 2-ethyl-4-(4-methyl-1,4-diazepan-1-yl)but-2-enoate |
| SMILES | CCC(=CCN1CCCN(C)CC1)C(=O)OC |
| InChI | InChI=1S/C13H24N2O2/c1-4-12(13(16)17-3)6-9-15-8-5-7-14(2)10-11-15/h6H,4-5,7-11H2,1-3H3 |
| InChIKey | RXNZKGRNQLPWKY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-ethyl-4-(4-methyl-1,4-diazepan-1-yl)but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-ethyl-4-(4-methyl-1,4-diazepan-1-yl)but-2-enoate?
The IUPAC name of methyl 2-ethyl-4-(4-methyl-1,4-diazepan-1-yl)but-2-enoate (CID 77100973) is methyl 2-ethyl-4-(4-methyl-1,4-diazepan-1-yl)but-2-enoate.
What is the SMILES notation for methyl 2-ethyl-4-(4-methyl-1,4-diazepan-1-yl)but-2-enoate?
The canonical SMILES for methyl 2-ethyl-4-(4-methyl-1,4-diazepan-1-yl)but-2-enoate is CCC(=CCN1CCCN(C)CC1)C(=O)OC.
What is the InChIKey of methyl 2-ethyl-4-(4-methyl-1,4-diazepan-1-yl)but-2-enoate?
The InChIKey is RXNZKGRNQLPWKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O2/c1-4-12(13(16)17-3)6-9-15-8-5-7-14(2)10-11-15/h6H,4-5,7-11H2,1-3H3.
What are the key properties of methyl 2-ethyl-4-(4-methyl-1,4-diazepan-1-yl)but-2-enoate?
methyl 2-ethyl-4-(4-methyl-1,4-diazepan-1-yl)but-2-enoate has a molecular weight of 240.35 g/mol, XLogP of 1.13, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-ethyl-4-(4-methyl-1,4-diazepan-1-yl)but-2-enoate is sourced from PubChem (CID 77100973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).