C12H19N3O2 — CID 77101079
4-(3,5-diethyl-1,2,4-triazol-1-yl)-2-ethylbut-2-enoic acid (PubChem CID 77101079) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 4-(3,5-diethyl-1,2,4-triazol-1-yl)-2-ethylbut-2-enoic acid.
| Compound Name | 4-(3,5-diethyl-1,2,4-triazol-1-yl)-2-ethylbut-2-enoic acid |
|---|---|
| PubChem CID | 77101079 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 4-(3,5-diethyl-1,2,4-triazol-1-yl)-2-ethylbut-2-enoic acid |
| SMILES | CCC(=CCn1nc(CC)nc1CC)C(=O)O |
| InChI | InChI=1S/C12H19N3O2/c1-4-9(12(16)17)7-8-15-11(6-3)13-10(5-2)14-15/h7H,4-6,8H2,1-3H3,(H,16,17) |
| InChIKey | BUWCOELDMRJYNH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|