4-(3,5-diethyl-1,2,4-triazol-1-yl)-2-ethylbut-2-enoic acid

C12H19N3O2 — CID 77101079

IUPAC4-(3,5-diethyl-1,2,4-triazol-1-yl)-2-ethylbut-2-enoic acid
SMILESCCC(=CCn1nc(CC)nc1CC)C(=O)O
InChIInChI=1S/C12H19N3O2/c1-4-9(12(16)17)7-8-15-11(6-3)13-10(5-2)14-15/h7H,4-6,8H2,1-3H3,(H,16,17)
InChIKeyBUWCOELDMRJYNH-UHFFFAOYSA-N
MW237.30 g/mol
LogP1.82
Rot. Bonds6

About 4-(3,5-diethyl-1,2,4-triazol-1-yl)-2-ethylbut-2-enoic acid

4-(3,5-diethyl-1,2,4-triazol-1-yl)-2-ethylbut-2-enoic acid (PubChem CID 77101079) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 4-(3,5-diethyl-1,2,4-triazol-1-yl)-2-ethylbut-2-enoic acid.

Molecular Properties

Compound Name4-(3,5-diethyl-1,2,4-triazol-1-yl)-2-ethylbut-2-enoic acid
PubChem CID77101079
Molecular FormulaC12H19N3O2
Molecular Weight237.30 g/mol
Exact Mass237.15
IUPAC Name4-(3,5-diethyl-1,2,4-triazol-1-yl)-2-ethylbut-2-enoic acid
SMILESCCC(=CCn1nc(CC)nc1CC)C(=O)O
InChIInChI=1S/C12H19N3O2/c1-4-9(12(16)17)7-8-15-11(6-3)13-10(5-2)14-15/h7H,4-6,8H2,1-3H3,(H,16,17)
InChIKeyBUWCOELDMRJYNH-UHFFFAOYSA-N
XLogP1.82
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.30
LogP ≤ 51.82
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 4-(3,5-diethyl-1,2,4-triazol-1-yl)-2-ethylbut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3,5-diethyl-1,2,4-triazol-1-yl)-2-ethylbut-2-enoic acid?
The IUPAC name of 4-(3,5-diethyl-1,2,4-triazol-1-yl)-2-ethylbut-2-enoic acid (CID 77101079) is 4-(3,5-diethyl-1,2,4-triazol-1-yl)-2-ethylbut-2-enoic acid.
What is the SMILES notation for 4-(3,5-diethyl-1,2,4-triazol-1-yl)-2-ethylbut-2-enoic acid?
The canonical SMILES for 4-(3,5-diethyl-1,2,4-triazol-1-yl)-2-ethylbut-2-enoic acid is CCC(=CCn1nc(CC)nc1CC)C(=O)O.
What is the InChIKey of 4-(3,5-diethyl-1,2,4-triazol-1-yl)-2-ethylbut-2-enoic acid?
The InChIKey is BUWCOELDMRJYNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O2/c1-4-9(12(16)17)7-8-15-11(6-3)13-10(5-2)14-15/h7H,4-6,8H2,1-3H3,(H,16,17).
What are the key properties of 4-(3,5-diethyl-1,2,4-triazol-1-yl)-2-ethylbut-2-enoic acid?
4-(3,5-diethyl-1,2,4-triazol-1-yl)-2-ethylbut-2-enoic acid has a molecular weight of 237.30 g/mol, XLogP of 1.82, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-diethyl-1,2,4-triazol-1-yl)-2-ethylbut-2-enoic acid is sourced from PubChem (CID 77101079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).