About 2-ethyl-4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid
2-ethyl-4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid (PubChem CID 77101387) has the molecular formula C10H12N2O5
and a molecular weight of 240.21 g/mol. Its IUPAC name is 2-ethyl-4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid.
Molecular Properties
| Compound Name | 2-ethyl-4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid |
| PubChem CID | 77101387 |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 2-ethyl-4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid |
| SMILES | CCC(=CCN1C(=O)C(=O)N(C)C1=O)C(=O)O |
| InChI | InChI=1S/C10H12N2O5/c1-3-6(9(15)16)4-5-12-8(14)7(13)11(2)10(12)17/h4H,3,5H2,1-2H3,(H,15,16) |
| InChIKey | YZTXWCARJJWBFE-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid?
The IUPAC name of 2-ethyl-4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid (CID 77101387) is 2-ethyl-4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid.
What is the SMILES notation for 2-ethyl-4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid?
The canonical SMILES for 2-ethyl-4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid is CCC(=CCN1C(=O)C(=O)N(C)C1=O)C(=O)O.
What is the InChIKey of 2-ethyl-4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid?
The InChIKey is YZTXWCARJJWBFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O5/c1-3-6(9(15)16)4-5-12-8(14)7(13)11(2)10(12)17/h4H,3,5H2,1-2H3,(H,15,16).
What are the key properties of 2-ethyl-4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid?
2-ethyl-4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid has a molecular weight of 240.21 g/mol, XLogP of -0.17, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)but-2-enoic acid is sourced from PubChem (CID 77101387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).