About methyl 2-ethyl-4-[4-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-1-yl]but-2-enoate
methyl 2-ethyl-4-[4-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-1-yl]but-2-enoate (PubChem CID 77101402) has the molecular formula C12H15F3N2O4
and a molecular weight of 308.26 g/mol. Its IUPAC name is methyl 2-ethyl-4-[4-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-1-yl]but-2-enoate.
Molecular Properties
| Compound Name | methyl 2-ethyl-4-[4-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-1-yl]but-2-enoate |
| PubChem CID | 77101402 |
| Molecular Formula | C12H15F3N2O4 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | methyl 2-ethyl-4-[4-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-1-yl]but-2-enoate |
| SMILES | CCC(=CCN1C(=O)NC(C)(C(F)(F)F)C1=O)C(=O)OC |
| InChI | InChI=1S/C12H15F3N2O4/c1-4-7(8(18)21-3)5-6-17-9(19)11(2,12(13,14)15)16-10(17)20/h5H,4,6H2,1-3H3,(H,16,20) |
| InChIKey | NNLRRFRALMBLDM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-ethyl-4-[4-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-1-yl]but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-ethyl-4-[4-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-1-yl]but-2-enoate?
The IUPAC name of methyl 2-ethyl-4-[4-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-1-yl]but-2-enoate (CID 77101402) is methyl 2-ethyl-4-[4-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-1-yl]but-2-enoate.
What is the SMILES notation for methyl 2-ethyl-4-[4-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-1-yl]but-2-enoate?
The canonical SMILES for methyl 2-ethyl-4-[4-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-1-yl]but-2-enoate is CCC(=CCN1C(=O)NC(C)(C(F)(F)F)C1=O)C(=O)OC.
What is the InChIKey of methyl 2-ethyl-4-[4-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-1-yl]but-2-enoate?
The InChIKey is NNLRRFRALMBLDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F3N2O4/c1-4-7(8(18)21-3)5-6-17-9(19)11(2,12(13,14)15)16-10(17)20/h5H,4,6H2,1-3H3,(H,16,20).
What are the key properties of methyl 2-ethyl-4-[4-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-1-yl]but-2-enoate?
methyl 2-ethyl-4-[4-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-1-yl]but-2-enoate has a molecular weight of 308.26 g/mol, XLogP of 1.37, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-ethyl-4-[4-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-1-yl]but-2-enoate is sourced from PubChem (CID 77101402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).