2-ethyl-4-[methyl(3,3,3-trifluoropropyl)amino]but-2-enoic acid

C10H16F3NO2 — CID 77101791

IUPAC2-ethyl-4-[methyl(3,3,3-trifluoropropyl)amino]but-2-enoic acid
SMILESCCC(=CCN(C)CCC(F)(F)F)C(=O)O
InChIInChI=1S/C10H16F3NO2/c1-3-8(9(15)16)4-6-14(2)7-5-10(11,12)13/h4H,3,5-7H2,1-2H3,(H,15,16)
InChIKeyIJDGUUIMLBVPPY-UHFFFAOYSA-N
MW239.24 g/mol
LogP2.29
Rot. Bonds6

About 2-ethyl-4-[methyl(3,3,3-trifluoropropyl)amino]but-2-enoic acid

2-ethyl-4-[methyl(3,3,3-trifluoropropyl)amino]but-2-enoic acid (PubChem CID 77101791) has the molecular formula C10H16F3NO2 and a molecular weight of 239.24 g/mol. Its IUPAC name is 2-ethyl-4-[methyl(3,3,3-trifluoropropyl)amino]but-2-enoic acid.

Molecular Properties

Compound Name2-ethyl-4-[methyl(3,3,3-trifluoropropyl)amino]but-2-enoic acid
PubChem CID77101791
Molecular FormulaC10H16F3NO2
Molecular Weight239.24 g/mol
Exact Mass239.11
IUPAC Name2-ethyl-4-[methyl(3,3,3-trifluoropropyl)amino]but-2-enoic acid
SMILESCCC(=CCN(C)CCC(F)(F)F)C(=O)O
InChIInChI=1S/C10H16F3NO2/c1-3-8(9(15)16)4-6-14(2)7-5-10(11,12)13/h4H,3,5-7H2,1-2H3,(H,15,16)
InChIKeyIJDGUUIMLBVPPY-UHFFFAOYSA-N
XLogP2.29
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.24
LogP ≤ 52.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-ethyl-4-[methyl(3,3,3-trifluoropropyl)amino]but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethyl-4-[methyl(3,3,3-trifluoropropyl)amino]but-2-enoic acid?
The IUPAC name of 2-ethyl-4-[methyl(3,3,3-trifluoropropyl)amino]but-2-enoic acid (CID 77101791) is 2-ethyl-4-[methyl(3,3,3-trifluoropropyl)amino]but-2-enoic acid.
What is the SMILES notation for 2-ethyl-4-[methyl(3,3,3-trifluoropropyl)amino]but-2-enoic acid?
The canonical SMILES for 2-ethyl-4-[methyl(3,3,3-trifluoropropyl)amino]but-2-enoic acid is CCC(=CCN(C)CCC(F)(F)F)C(=O)O.
What is the InChIKey of 2-ethyl-4-[methyl(3,3,3-trifluoropropyl)amino]but-2-enoic acid?
The InChIKey is IJDGUUIMLBVPPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F3NO2/c1-3-8(9(15)16)4-6-14(2)7-5-10(11,12)13/h4H,3,5-7H2,1-2H3,(H,15,16).
What are the key properties of 2-ethyl-4-[methyl(3,3,3-trifluoropropyl)amino]but-2-enoic acid?
2-ethyl-4-[methyl(3,3,3-trifluoropropyl)amino]but-2-enoic acid has a molecular weight of 239.24 g/mol, XLogP of 2.29, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-[methyl(3,3,3-trifluoropropyl)amino]but-2-enoic acid is sourced from PubChem (CID 77101791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).