C14H24O3 — CID 77101806
2-ethyl-4-(3-ethylcyclohexyl)oxybut-2-enoic acid (PubChem CID 77101806) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is 2-ethyl-4-(3-ethylcyclohexyl)oxybut-2-enoic acid.
| Compound Name | 2-ethyl-4-(3-ethylcyclohexyl)oxybut-2-enoic acid |
|---|---|
| PubChem CID | 77101806 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 2-ethyl-4-(3-ethylcyclohexyl)oxybut-2-enoic acid |
| SMILES | CCC(=CCOC1CCCC(CC)C1)C(=O)O |
| InChI | InChI=1S/C14H24O3/c1-3-11-6-5-7-13(10-11)17-9-8-12(4-2)14(15)16/h8,11,13H,3-7,9-10H2,1-2H3,(H,15,16) |
| InChIKey | FTZDPZOZAGNBRU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|