C16H12FN3O3 — CID 7710203
N-[4-(4-fluorophenyl)-1,2,5-oxadiazol-3-yl]-2-methoxybenzamide (PubChem CID 7710203) has the molecular formula C16H12FN3O3 and a molecular weight of 313.29 g/mol. Its IUPAC name is N-[4-(4-fluorophenyl)-1,2,5-oxadiazol-3-yl]-2-methoxybenzamide.
| Compound Name | N-[4-(4-fluorophenyl)-1,2,5-oxadiazol-3-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 7710203 |
| Molecular Formula | C16H12FN3O3 |
| Molecular Weight | 313.29 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | N-[4-(4-fluorophenyl)-1,2,5-oxadiazol-3-yl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)Nc1nonc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C16H12FN3O3/c1-22-13-5-3-2-4-12(13)16(21)18-15-14(19-23-20-15)10-6-8-11(17)9-7-10/h2-9H,1H3,(H,18,20,21) |
| InChIKey | VWRLEVXYEDEBFP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |