C13H14F2O2S — CID 77102151
methyl 4-(3,4-difluorophenyl)sulfanyl-2-ethylbut-2-enoate (PubChem CID 77102151) has the molecular formula C13H14F2O2S and a molecular weight of 272.32 g/mol. Its IUPAC name is methyl 4-(3,4-difluorophenyl)sulfanyl-2-ethylbut-2-enoate.
| Compound Name | methyl 4-(3,4-difluorophenyl)sulfanyl-2-ethylbut-2-enoate |
|---|---|
| PubChem CID | 77102151 |
| Molecular Formula | C13H14F2O2S |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | methyl 4-(3,4-difluorophenyl)sulfanyl-2-ethylbut-2-enoate |
| SMILES | CCC(=CCSc1ccc(F)c(F)c1)C(=O)OC |
| InChI | InChI=1S/C13H14F2O2S/c1-3-9(13(16)17-2)6-7-18-10-4-5-11(14)12(15)8-10/h4-6,8H,3,7H2,1-2H3 |
| InChIKey | CAFAFDQLUOXTDY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|