4-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-ethylbut-2-enoic acid

C11H16N2O2S — CID 77102376

IUPAC4-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-ethylbut-2-enoic acid
SMILESCCC(=CCSc1cc(C)nn1C)C(=O)O
InChIInChI=1S/C11H16N2O2S/c1-4-9(11(14)15)5-6-16-10-7-8(2)12-13(10)3/h5,7H,4,6H2,1-3H3,(H,14,15)
InChIKeyRAVKUJHKZUFBEI-UHFFFAOYSA-N
MW240.33 g/mol
LogP2.24
Rot. Bonds5

About 4-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-ethylbut-2-enoic acid

4-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-ethylbut-2-enoic acid (PubChem CID 77102376) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is 4-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-ethylbut-2-enoic acid.

Molecular Properties

Compound Name4-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-ethylbut-2-enoic acid
PubChem CID77102376
Molecular FormulaC11H16N2O2S
Molecular Weight240.33 g/mol
Exact Mass240.09
IUPAC Name4-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-ethylbut-2-enoic acid
SMILESCCC(=CCSc1cc(C)nn1C)C(=O)O
InChIInChI=1S/C11H16N2O2S/c1-4-9(11(14)15)5-6-16-10-7-8(2)12-13(10)3/h5,7H,4,6H2,1-3H3,(H,14,15)
InChIKeyRAVKUJHKZUFBEI-UHFFFAOYSA-N
XLogP2.24
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.33
LogP ≤ 52.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 4-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-ethylbut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-ethylbut-2-enoic acid?
The IUPAC name of 4-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-ethylbut-2-enoic acid (CID 77102376) is 4-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-ethylbut-2-enoic acid.
What is the SMILES notation for 4-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-ethylbut-2-enoic acid?
The canonical SMILES for 4-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-ethylbut-2-enoic acid is CCC(=CCSc1cc(C)nn1C)C(=O)O.
What is the InChIKey of 4-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-ethylbut-2-enoic acid?
The InChIKey is RAVKUJHKZUFBEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2S/c1-4-9(11(14)15)5-6-16-10-7-8(2)12-13(10)3/h5,7H,4,6H2,1-3H3,(H,14,15).
What are the key properties of 4-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-ethylbut-2-enoic acid?
4-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-ethylbut-2-enoic acid has a molecular weight of 240.33 g/mol, XLogP of 2.24, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-ethylbut-2-enoic acid is sourced from PubChem (CID 77102376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).