C10H19F3N2O2 — CID 77102472
N'-hydroxy-2,2-dimethyl-5-(1,1,1-trifluoropropan-2-yloxy)pentanimidamide (PubChem CID 77102472) has the molecular formula C10H19F3N2O2 and a molecular weight of 256.27 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-5-(1,1,1-trifluoropropan-2-yloxy)pentanimidamide.
| Compound Name | N'-hydroxy-2,2-dimethyl-5-(1,1,1-trifluoropropan-2-yloxy)pentanimidamide |
|---|---|
| PubChem CID | 77102472 |
| Molecular Formula | C10H19F3N2O2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-5-(1,1,1-trifluoropropan-2-yloxy)pentanimidamide |
| SMILES | CC(OCCCC(C)(C)C(N)=NO)C(F)(F)F |
| InChI | InChI=1S/C10H19F3N2O2/c1-7(10(11,12)13)17-6-4-5-9(2,3)8(14)15-16/h7,16H,4-6H2,1-3H3,(H2,14,15) |
| InChIKey | FKAIDRHKITUQRK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|