C13H21NO2 — CID 77103959
N-[[2-(hydroxymethyl)cyclopentyl]methyl]hexa-2,4-dienamide (PubChem CID 77103959) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is N-[[2-(hydroxymethyl)cyclopentyl]methyl]hexa-2,4-dienamide.
| Compound Name | N-[[2-(hydroxymethyl)cyclopentyl]methyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 77103959 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | N-[[2-(hydroxymethyl)cyclopentyl]methyl]hexa-2,4-dienamide |
| SMILES | CC=CC=CC(=O)NCC1CCCC1CO |
| InChI | InChI=1S/C13H21NO2/c1-2-3-4-8-13(16)14-9-11-6-5-7-12(11)10-15/h2-4,8,11-12,15H,5-7,9-10H2,1H3,(H,14,16) |
| InChIKey | ANUKNPKDJHXHMR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|