C36H34F7NO5 — CID 77105307
4-[5-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-2-fluoro-4-methoxyphenyl]-3-methylbenzoic acid (PubChem CID 77105307) has the molecular formula C36H34F7NO5 and a molecular weight of 693.66 g/mol. Its IUPAC name is 4-[5-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-2-fluoro-4-methoxyphenyl]-3-methylbenzoic acid.
| Compound Name | 4-[5-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-2-fluoro-4-methoxyphenyl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 77105307 |
| Molecular Formula | C36H34F7NO5 |
| Molecular Weight | 693.66 g/mol |
| Exact Mass | 693.23 |
| IUPAC Name | 4-[5-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-2-fluoro-4-methoxyphenyl]-3-methylbenzoic acid |
| SMILES | COc1cc(F)c(-c2ccc(C(=O)O)cc2C)cc1C1=C(CN2C(=O)O[C@H](c3cc(C(F)(F)F)cc(C(F)(F)F)c3)[C@@H]2C)CC(C)(C)CC1 |
| InChI | InChI=1S/C36H34F7NO5/c1-18-10-20(32(45)46)6-7-25(18)27-14-28(30(48-5)15-29(27)37)26-8-9-34(3,4)16-22(26)17-44-19(2)31(49-33(44)47)21-11-23(35(38,39)40)13-24(12-21)36(41,42)43/h6-7,10-15,19,31H,8-9,16-17H2,1-5H3,(H,45,46)/t19-,31-/m0/s1 |
| InChIKey | FHYBPDXYDXKVJB-RQZFFVEVSA-N |
| XLogP | 10.09 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.66 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |