C37H37F6NO5 — CID 77105309
4-[5-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-4-methoxy-2-methylphenyl]-3-methylbenzoic acid (PubChem CID 77105309) has the molecular formula C37H37F6NO5 and a molecular weight of 689.69 g/mol. Its IUPAC name is 4-[5-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-4-methoxy-2-methylphenyl]-3-methylbenzoic acid.
| Compound Name | 4-[5-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-4-methoxy-2-methylphenyl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 77105309 |
| Molecular Formula | C37H37F6NO5 |
| Molecular Weight | 689.69 g/mol |
| Exact Mass | 689.26 |
| IUPAC Name | 4-[5-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-4-methoxy-2-methylphenyl]-3-methylbenzoic acid |
| SMILES | COc1cc(C)c(-c2ccc(C(=O)O)cc2C)cc1C1=C(CN2C(=O)O[C@H](c3cc(C(F)(F)F)cc(C(F)(F)F)c3)[C@@H]2C)CC(C)(C)CC1 |
| InChI | InChI=1S/C37H37F6NO5/c1-19-11-22(33(45)46)7-8-27(19)29-16-30(31(48-6)12-20(29)2)28-9-10-35(4,5)17-24(28)18-44-21(3)32(49-34(44)47)23-13-25(36(38,39)40)15-26(14-23)37(41,42)43/h7-8,11-16,21,32H,9-10,17-18H2,1-6H3,(H,45,46)/t21-,32-/m0/s1 |
| InChIKey | JZCDRLOHYWCQGY-MNAQKMTRSA-N |
| XLogP | 10.26 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.69 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |