C36H35F6NO4 — CID 77105312
4-[5-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-2-methylphenyl]-3-methylbenzoic acid (PubChem CID 77105312) has the molecular formula C36H35F6NO4 and a molecular weight of 659.67 g/mol. Its IUPAC name is 4-[5-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-2-methylphenyl]-3-methylbenzoic acid.
| Compound Name | 4-[5-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-2-methylphenyl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 77105312 |
| Molecular Formula | C36H35F6NO4 |
| Molecular Weight | 659.67 g/mol |
| Exact Mass | 659.25 |
| IUPAC Name | 4-[5-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-2-methylphenyl]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1-c1cc(C2=C(CN3C(=O)O[C@H](c4cc(C(F)(F)F)cc(C(F)(F)F)c4)[C@@H]3C)CC(C)(C)CC2)ccc1C |
| InChI | InChI=1S/C36H35F6NO4/c1-19-6-7-22(15-30(19)28-9-8-23(32(44)45)12-20(28)2)29-10-11-34(4,5)17-25(29)18-43-21(3)31(47-33(43)46)24-13-26(35(37,38)39)16-27(14-24)36(40,41)42/h6-9,12-16,21,31H,10-11,17-18H2,1-5H3,(H,44,45)/t21-,31-/m0/s1 |
| InChIKey | AZFSMKZMGFOEJM-BGOLNKOXSA-N |
| XLogP | 10.25 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.67 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |