C37H38F6N2O5 — CID 77105496
4-[5-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-6-methoxy-3-pyridinyl]-3-propan-2-ylbenzoic acid (PubChem CID 77105496) has the molecular formula C37H38F6N2O5 and a molecular weight of 704.71 g/mol. Its IUPAC name is 4-[5-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-6-methoxy-3-pyridinyl]-3-propan-2-ylbenzoic acid.
| Compound Name | 4-[5-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-6-methoxy-3-pyridinyl]-3-propan-2-ylbenzoic acid |
|---|---|
| PubChem CID | 77105496 |
| Molecular Formula | C37H38F6N2O5 |
| Molecular Weight | 704.71 g/mol |
| Exact Mass | 704.27 |
| IUPAC Name | 4-[5-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]-4,4-dimethylcyclohexen-1-yl]-6-methoxy-3-pyridinyl]-3-propan-2-ylbenzoic acid |
| SMILES | COc1ncc(-c2ccc(C(=O)O)cc2C(C)C)cc1C1=C(CN2C(=O)O[C@H](c3cc(C(F)(F)F)cc(C(F)(F)F)c3)[C@@H]2C)CC(C)(C)CC1 |
| InChI | InChI=1S/C37H38F6N2O5/c1-19(2)29-13-21(33(46)47)7-8-27(29)23-14-30(32(49-6)44-17-23)28-9-10-35(4,5)16-24(28)18-45-20(3)31(50-34(45)48)22-11-25(36(38,39)40)15-26(12-22)37(41,42)43/h7-8,11-15,17,19-20,31H,9-10,16,18H2,1-6H3,(H,46,47)/t20-,31-/m0/s1 |
| InChIKey | MEQFCGRHVUBUPH-GEFUHLBYSA-N |
| XLogP | 10.16 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.71 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |