About 9-methoxy-11H-pyrido[4,3-a]carbazole-6-carboxamide
9-methoxy-11H-pyrido[4,3-a]carbazole-6-carboxamide (PubChem CID 77105817) has the molecular formula C17H13N3O2
and a molecular weight of 291.31 g/mol. Its IUPAC name is 9-methoxy-11H-pyrido[4,3-a]carbazole-6-carboxamide.
Molecular Properties
| Compound Name | 9-methoxy-11H-pyrido[4,3-a]carbazole-6-carboxamide |
| PubChem CID | 77105817 |
| Molecular Formula | C17H13N3O2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 9-methoxy-11H-pyrido[4,3-a]carbazole-6-carboxamide |
| SMILES | COc1ccc2c(c1)[nH]c1c3ccncc3cc(C(N)=O)c21 |
| InChI | InChI=1S/C17H13N3O2/c1-22-10-2-3-12-14(7-10)20-16-11-4-5-19-8-9(11)6-13(15(12)16)17(18)21/h2-8,20H,1H3,(H2,18,21) |
| InChIKey | MWBWBNKXYNJCMP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-methoxy-11H-pyrido[4,3-a]carbazole-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methoxy-11H-pyrido[4,3-a]carbazole-6-carboxamide?
The IUPAC name of 9-methoxy-11H-pyrido[4,3-a]carbazole-6-carboxamide (CID 77105817) is 9-methoxy-11H-pyrido[4,3-a]carbazole-6-carboxamide.
What is the SMILES notation for 9-methoxy-11H-pyrido[4,3-a]carbazole-6-carboxamide?
The canonical SMILES for 9-methoxy-11H-pyrido[4,3-a]carbazole-6-carboxamide is COc1ccc2c(c1)[nH]c1c3ccncc3cc(C(N)=O)c21.
What is the InChIKey of 9-methoxy-11H-pyrido[4,3-a]carbazole-6-carboxamide?
The InChIKey is MWBWBNKXYNJCMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N3O2/c1-22-10-2-3-12-14(7-10)20-16-11-4-5-19-8-9(11)6-13(15(12)16)17(18)21/h2-8,20H,1H3,(H2,18,21).
What are the key properties of 9-methoxy-11H-pyrido[4,3-a]carbazole-6-carboxamide?
9-methoxy-11H-pyrido[4,3-a]carbazole-6-carboxamide has a molecular weight of 291.31 g/mol, XLogP of 2.98, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methoxy-11H-pyrido[4,3-a]carbazole-6-carboxamide is sourced from PubChem (CID 77105817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).