About 7-methoxy-11H-pyrido[4,3-a]carbazole-6-carbonitrile
7-methoxy-11H-pyrido[4,3-a]carbazole-6-carbonitrile (PubChem CID 77106026) has the molecular formula C17H11N3O
and a molecular weight of 273.30 g/mol. Its IUPAC name is 7-methoxy-11H-pyrido[4,3-a]carbazole-6-carbonitrile.
Molecular Properties
| Compound Name | 7-methoxy-11H-pyrido[4,3-a]carbazole-6-carbonitrile |
| PubChem CID | 77106026 |
| Molecular Formula | C17H11N3O |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 7-methoxy-11H-pyrido[4,3-a]carbazole-6-carbonitrile |
| SMILES | COc1cccc2[nH]c3c4ccncc4cc(C#N)c3c12 |
| InChI | InChI=1S/C17H11N3O/c1-21-14-4-2-3-13-16(14)15-10(8-18)7-11-9-19-6-5-12(11)17(15)20-13/h2-7,9,20H,1H3 |
| InChIKey | DSISPBFCWKLZEA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 61.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methoxy-11H-pyrido[4,3-a]carbazole-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-11H-pyrido[4,3-a]carbazole-6-carbonitrile?
The IUPAC name of 7-methoxy-11H-pyrido[4,3-a]carbazole-6-carbonitrile (CID 77106026) is 7-methoxy-11H-pyrido[4,3-a]carbazole-6-carbonitrile.
What is the SMILES notation for 7-methoxy-11H-pyrido[4,3-a]carbazole-6-carbonitrile?
The canonical SMILES for 7-methoxy-11H-pyrido[4,3-a]carbazole-6-carbonitrile is COc1cccc2[nH]c3c4ccncc4cc(C#N)c3c12.
What is the InChIKey of 7-methoxy-11H-pyrido[4,3-a]carbazole-6-carbonitrile?
The InChIKey is DSISPBFCWKLZEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11N3O/c1-21-14-4-2-3-13-16(14)15-10(8-18)7-11-9-19-6-5-12(11)17(15)20-13/h2-7,9,20H,1H3.
What are the key properties of 7-methoxy-11H-pyrido[4,3-a]carbazole-6-carbonitrile?
7-methoxy-11H-pyrido[4,3-a]carbazole-6-carbonitrile has a molecular weight of 273.30 g/mol, XLogP of 3.75, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-11H-pyrido[4,3-a]carbazole-6-carbonitrile is sourced from PubChem (CID 77106026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).