C21H36N6O2S — CID 77106087
(4aR,7R,8aR)-2-amino-N-butyl-N-[2-(dimethylamino)ethylcarbamoyl]-5-methyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]thiazolo[4,5-g]quinoline-7-carboxamide (PubChem CID 77106087) has the molecular formula C21H36N6O2S and a molecular weight of 436.63 g/mol. Its IUPAC name is (4aR,7R,8aR)-2-amino-N-butyl-N-[2-(dimethylamino)ethylcarbamoyl]-5-methyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]thiazolo[4,5-g]quinoline-7-carboxamide.
| Compound Name | (4aR,7R,8aR)-2-amino-N-butyl-N-[2-(dimethylamino)ethylcarbamoyl]-5-methyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]thiazolo[4,5-g]quinoline-7-carboxamide |
|---|---|
| PubChem CID | 77106087 |
| Molecular Formula | C21H36N6O2S |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | (4aR,7R,8aR)-2-amino-N-butyl-N-[2-(dimethylamino)ethylcarbamoyl]-5-methyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]thiazolo[4,5-g]quinoline-7-carboxamide |
| SMILES | CCCCN(C(=O)NCCN(C)C)C(=O)[C@@H]1C[C@@H]2Cc3nc(N)sc3C[C@H]2N(C)C1 |
| InChI | InChI=1S/C21H36N6O2S/c1-5-6-8-27(21(29)23-7-9-25(2)3)19(28)15-10-14-11-16-18(30-20(22)24-16)12-17(14)26(4)13-15/h14-15,17H,5-13H2,1-4H3,(H2,22,24)(H,23,29)/t14-,15-,17-/m1/s1 |
| InChIKey | LYNFMYZCKAPULX-BFYDXBDKSA-N |
| XLogP | 1.66 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |