C20H14F5N3O — CID 77106313
4-(2,6-difluoro-4-prop-2-ynoxyphenyl)-1,3-dimethyl-N-(2,4,6-trifluorophenyl)pyrazol-5-amine (PubChem CID 77106313) has the molecular formula C20H14F5N3O and a molecular weight of 407.34 g/mol. Its IUPAC name is 4-(2,6-difluoro-4-prop-2-ynoxyphenyl)-1,3-dimethyl-N-(2,4,6-trifluorophenyl)pyrazol-5-amine.
| Compound Name | 4-(2,6-difluoro-4-prop-2-ynoxyphenyl)-1,3-dimethyl-N-(2,4,6-trifluorophenyl)pyrazol-5-amine |
|---|---|
| PubChem CID | 77106313 |
| Molecular Formula | C20H14F5N3O |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 4-(2,6-difluoro-4-prop-2-ynoxyphenyl)-1,3-dimethyl-N-(2,4,6-trifluorophenyl)pyrazol-5-amine |
| SMILES | C#CCOc1cc(F)c(-c2c(C)nn(C)c2Nc2c(F)cc(F)cc2F)c(F)c1 |
| InChI | InChI=1S/C20H14F5N3O/c1-4-5-29-12-8-13(22)18(14(23)9-12)17-10(2)27-28(3)20(17)26-19-15(24)6-11(21)7-16(19)25/h1,6-9,26H,5H2,2-3H3 |
| InChIKey | NCYAYHOUSGUVPB-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|