C20H23Cl2N3O2 — CID 77106978
N-(4-amino-2-chlorophenyl)-5-chloro-2-(2-piperidin-4-ylethoxy)benzamide (PubChem CID 77106978) has the molecular formula C20H23Cl2N3O2 and a molecular weight of 408.33 g/mol. Its IUPAC name is N-(4-amino-2-chlorophenyl)-5-chloro-2-(2-piperidin-4-ylethoxy)benzamide.
| Compound Name | N-(4-amino-2-chlorophenyl)-5-chloro-2-(2-piperidin-4-ylethoxy)benzamide |
|---|---|
| PubChem CID | 77106978 |
| Molecular Formula | C20H23Cl2N3O2 |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | N-(4-amino-2-chlorophenyl)-5-chloro-2-(2-piperidin-4-ylethoxy)benzamide |
| SMILES | Nc1ccc(NC(=O)c2cc(Cl)ccc2OCCC2CCNCC2)c(Cl)c1 |
| InChI | InChI=1S/C20H23Cl2N3O2/c21-14-1-4-19(27-10-7-13-5-8-24-9-6-13)16(11-14)20(26)25-18-3-2-15(23)12-17(18)22/h1-4,11-13,24H,5-10,23H2,(H,25,26) |
| InChIKey | UJYHZCWNZZIBBH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|