About N-[4,5-dimethyl-6-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]-1H-indazol-5-amine
N-[4,5-dimethyl-6-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]-1H-indazol-5-amine (PubChem CID 77108301) has the molecular formula C20H16F3N5O
and a molecular weight of 399.38 g/mol. Its IUPAC name is N-[4,5-dimethyl-6-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]-1H-indazol-5-amine.
Molecular Properties
| Compound Name | N-[4,5-dimethyl-6-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]-1H-indazol-5-amine |
| PubChem CID | 77108301 |
| Molecular Formula | C20H16F3N5O |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N-[4,5-dimethyl-6-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]-1H-indazol-5-amine |
| SMILES | Cc1nc(Nc2ccc3[nH]ncc3c2)nc(-c2ccc(OC(F)(F)F)cc2)c1C |
| InChI | InChI=1S/C20H16F3N5O/c1-11-12(2)25-19(26-15-5-8-17-14(9-15)10-24-28-17)27-18(11)13-3-6-16(7-4-13)29-20(21,22)23/h3-10H,1-2H3,(H,24,28)(H,25,26,27) |
| InChIKey | MOESPQDLCRELJK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4,5-dimethyl-6-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]-1H-indazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4,5-dimethyl-6-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]-1H-indazol-5-amine?
The IUPAC name of N-[4,5-dimethyl-6-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]-1H-indazol-5-amine (CID 77108301) is N-[4,5-dimethyl-6-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]-1H-indazol-5-amine.
What is the SMILES notation for N-[4,5-dimethyl-6-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]-1H-indazol-5-amine?
The canonical SMILES for N-[4,5-dimethyl-6-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]-1H-indazol-5-amine is Cc1nc(Nc2ccc3[nH]ncc3c2)nc(-c2ccc(OC(F)(F)F)cc2)c1C.
What is the InChIKey of N-[4,5-dimethyl-6-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]-1H-indazol-5-amine?
The InChIKey is MOESPQDLCRELJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16F3N5O/c1-11-12(2)25-19(26-15-5-8-17-14(9-15)10-24-28-17)27-18(11)13-3-6-16(7-4-13)29-20(21,22)23/h3-10H,1-2H3,(H,24,28)(H,25,26,27).
What are the key properties of N-[4,5-dimethyl-6-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]-1H-indazol-5-amine?
N-[4,5-dimethyl-6-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]-1H-indazol-5-amine has a molecular weight of 399.38 g/mol, XLogP of 5.28, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4,5-dimethyl-6-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]-1H-indazol-5-amine is sourced from PubChem (CID 77108301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).