C19H18N4S — CID 7710840
(Z,Z)-N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-2-methyl-3-phenylprop-2-en-1-imine (PubChem CID 7710840) has the molecular formula C19H18N4S and a molecular weight of 334.45 g/mol. Its IUPAC name is (Z,Z)-N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-2-methyl-3-phenylprop-2-en-1-imine.
| Compound Name | (Z,Z)-N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-2-methyl-3-phenylprop-2-en-1-imine |
|---|---|
| PubChem CID | 7710840 |
| Molecular Formula | C19H18N4S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | (Z,Z)-N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-2-methyl-3-phenylprop-2-en-1-imine |
| SMILES | CC(/C=N\n1cnnc1SCc1ccccc1)=C/c1ccccc1 |
| InChI | InChI=1S/C19H18N4S/c1-16(12-17-8-4-2-5-9-17)13-21-23-15-20-22-19(23)24-14-18-10-6-3-7-11-18/h2-13,15H,14H2,1H3/b16-12-,21-13- |
| InChIKey | JITDNHKTBMBULA-NKGTYGOKSA-N |
| XLogP | 4.51 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|