C13H25N3O2S — CID 77108952
1-hexanoyl-N'-hydroxy-4-methylsulfanylpiperidine-4-carboximidamide (PubChem CID 77108952) has the molecular formula C13H25N3O2S and a molecular weight of 287.43 g/mol. Its IUPAC name is 1-hexanoyl-N'-hydroxy-4-methylsulfanylpiperidine-4-carboximidamide.
| Compound Name | 1-hexanoyl-N'-hydroxy-4-methylsulfanylpiperidine-4-carboximidamide |
|---|---|
| PubChem CID | 77108952 |
| Molecular Formula | C13H25N3O2S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 1-hexanoyl-N'-hydroxy-4-methylsulfanylpiperidine-4-carboximidamide |
| SMILES | CCCCCC(=O)N1CCC(SC)(C(N)=NO)CC1 |
| InChI | InChI=1S/C13H25N3O2S/c1-3-4-5-6-11(17)16-9-7-13(19-2,8-10-16)12(14)15-18/h18H,3-10H2,1-2H3,(H2,14,15) |
| InChIKey | OZIAWWPVYHUGSO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|