C17H18N2O6 — CID 7710915
[(3R)-2-oxooxolan-3-yl] 2-[(4S)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 7710915) has the molecular formula C17H18N2O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is [(3R)-2-oxooxolan-3-yl] 2-[(4S)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | [(3R)-2-oxooxolan-3-yl] 2-[(4S)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 7710915 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | [(3R)-2-oxooxolan-3-yl] 2-[(4S)-4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | Cc1ccc([C@]2(C)NC(=O)N(CC(=O)O[C@@H]3CCOC3=O)C2=O)cc1 |
| InChI | InChI=1S/C17H18N2O6/c1-10-3-5-11(6-4-10)17(2)15(22)19(16(23)18-17)9-13(20)25-12-7-8-24-14(12)21/h3-6,12H,7-9H2,1-2H3,(H,18,23)/t12-,17+/m1/s1 |
| InChIKey | NWLGWIPDRLQNFF-PXAZEXFGSA-N |
| XLogP | 0.62 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|