About 3-[3-(2,5-dichlorophenyl)prop-2-enoylamino]cyclopentane-1-carboxylic acid
3-[3-(2,5-dichlorophenyl)prop-2-enoylamino]cyclopentane-1-carboxylic acid (PubChem CID 77110070) has the molecular formula C15H15Cl2NO3
and a molecular weight of 328.20 g/mol. Its IUPAC name is 3-[3-(2,5-dichlorophenyl)prop-2-enoylamino]cyclopentane-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-[3-(2,5-dichlorophenyl)prop-2-enoylamino]cyclopentane-1-carboxylic acid |
| PubChem CID | 77110070 |
| Molecular Formula | C15H15Cl2NO3 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 3-[3-(2,5-dichlorophenyl)prop-2-enoylamino]cyclopentane-1-carboxylic acid |
| SMILES | O=C(C=Cc1cc(Cl)ccc1Cl)NC1CCC(C(=O)O)C1 |
| InChI | InChI=1S/C15H15Cl2NO3/c16-11-3-5-13(17)9(7-11)2-6-14(19)18-12-4-1-10(8-12)15(20)21/h2-3,5-7,10,12H,1,4,8H2,(H,18,19)(H,20,21) |
| InChIKey | PKHSDZMWHPHXAT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(2,5-dichlorophenyl)prop-2-enoylamino]cyclopentane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(2,5-dichlorophenyl)prop-2-enoylamino]cyclopentane-1-carboxylic acid?
The IUPAC name of 3-[3-(2,5-dichlorophenyl)prop-2-enoylamino]cyclopentane-1-carboxylic acid (CID 77110070) is 3-[3-(2,5-dichlorophenyl)prop-2-enoylamino]cyclopentane-1-carboxylic acid.
What is the SMILES notation for 3-[3-(2,5-dichlorophenyl)prop-2-enoylamino]cyclopentane-1-carboxylic acid?
The canonical SMILES for 3-[3-(2,5-dichlorophenyl)prop-2-enoylamino]cyclopentane-1-carboxylic acid is O=C(C=Cc1cc(Cl)ccc1Cl)NC1CCC(C(=O)O)C1.
What is the InChIKey of 3-[3-(2,5-dichlorophenyl)prop-2-enoylamino]cyclopentane-1-carboxylic acid?
The InChIKey is PKHSDZMWHPHXAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15Cl2NO3/c16-11-3-5-13(17)9(7-11)2-6-14(19)18-12-4-1-10(8-12)15(20)21/h2-3,5-7,10,12H,1,4,8H2,(H,18,19)(H,20,21).
What are the key properties of 3-[3-(2,5-dichlorophenyl)prop-2-enoylamino]cyclopentane-1-carboxylic acid?
3-[3-(2,5-dichlorophenyl)prop-2-enoylamino]cyclopentane-1-carboxylic acid has a molecular weight of 328.20 g/mol, XLogP of 3.38, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(2,5-dichlorophenyl)prop-2-enoylamino]cyclopentane-1-carboxylic acid is sourced from PubChem (CID 77110070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).